Introduction:Basic information about CAS 19735-89-8|5-Methyl-2-phenyl-1,2-dihydropyrazol-3-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Methyl-2-phenyl-1,2-dihydropyrazol-3-one |
|---|
| CAS Number | 19735-89-8 | Molecular Weight | 174.199 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 276.4±23.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H10N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 121.0±22.6 °C |
|---|
Names
| Name | 5-Methyl-2-phenyl-1,2-dihydropyrazol-3-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 276.4±23.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H10N2O |
|---|
| Molecular Weight | 174.199 |
|---|
| Flash Point | 121.0±22.6 °C |
|---|
| Exact Mass | 174.079315 |
|---|
| PSA | 37.79000 |
|---|
| LogP | 1.72 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.587 |
|---|
| InChIKey | KZQYIMCESJLPQH-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(=O)n(-c2ccccc2)[nH]1 |
|---|
Safety Information
Customs
| HS Code | 2933199090 |
|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1-Phenyl-3-methylpyrazol-5-one |
| 3-methyl-1-phenyl-5-oxo-2,5-dihydro-1H-pyrazole |
| 5-Methyl-2-phenyl-1,2-dihydro-3H-pyrazol-3-one |
| 3-methyl-1-phenyl-3-pyrazolin-5-one |
| 3-Methyl-1-phenyl-5-pyrazolone |
| 3-methyl-1-phenyl-pyrazol-5-one |
| 3H-Pyrazol-3-one, 1,2-dihydro-5-methyl-2-phenyl- |
| 5-Methyl-2-phenyl-1,2-dihydro-3H-pyrazole-3-one |
| 1-Phenyl-3-methyl-1H-pyrazole-5(2H)-one |
| 2-phenyl-5-methyl-pyrazol-3-one |
| 1,2-dihydro-5-methyl-2-phenyl-3h-pyrazol-3-one |
| 1,2-Dihydro-5-methyl |
| 1-PHENYL-3-METHYL-5-PYRAZOLONE |
| 2-Phenyl-5-methyl-1,2-dihydro-3H-pyrazole-3-one |
| 2-Phenyl-5-methyl-1H-pyrazole-3(2H)-one |
| EINECS 243-261-8 |
| Edaravone Impurity 12 |