Introduction：Basic information about CAS 1260811-82-2|4'-Cyano-3'-fluorobiphenyl-4-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4'-Cyano-3'-fluorobiphenyl-4-carboxylic acid |
|---|
| CAS Number | 1260811-82-2 | Molecular Weight | 241.217 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 439.5±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H8FNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 219.6±27.3 °C |
|---|
Names
| Name | 4'-Cyano-3'-fluorobiphenyl-4-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 439.5±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H8FNO2 |
|---|
| Molecular Weight | 241.217 |
|---|
| Flash Point | 219.6±27.3 °C |
|---|
| Exact Mass | 241.053909 |
|---|
| PSA | 61.09000 |
|---|
| LogP | 2.89 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.630 |
|---|
| InChIKey | SVQNQAOEJZCAKW-UHFFFAOYSA-N |
|---|
| SMILES | N#Cc1ccc(-c2ccc(C(=O)O)cc2)cc1F |
|---|
Synonyms
| 4'-Cyano-3'-fluoro-4-biphenylcarboxylic acid |
| [1,1'-Biphenyl]-4-carboxylic acid, 4'-cyano-3'-fluoro- |
| 4-(4-cyano-3-fluorophenyl)benzoic acid |
| 4'-Cyano-3'-fluorobiphenyl-4-carboxylic acid |
