Introduction：Basic information about CAS 191605-10-4|Di-p-anisoyl-D-tartaric acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Di-p-anisoyl-D-tartaric acid |
|---|
| CAS Number | 191605-10-4 | Molecular Weight | 418.351 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 681.6±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H18O10 | Melting Point | 193-195ºC |
|---|
| MSDS | / | Flash Point | 241.6±25.0 °C |
|---|
Names
| Name | Di-p-anisoyl-D-tartaric acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 681.6±55.0 °C at 760 mmHg |
|---|
| Melting Point | 193-195ºC |
|---|
| Molecular Formula | C20H18O10 |
|---|
| Molecular Weight | 418.351 |
|---|
| Flash Point | 241.6±25.0 °C |
|---|
| Exact Mass | 418.089996 |
|---|
| PSA | 145.66000 |
|---|
| LogP | 5.97 |
|---|
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.586 |
|---|
| InChIKey | KWWCVCFQHGKOMI-HOTGVXAUSA-N |
|---|
| SMILES | COc1ccc(C(=O)OC(C(=O)O)C(OC(=O)c2ccc(OC)cc2)C(=O)O)cc1 |
|---|
Safety Information
Synonyms
| Butanedioic acid, 2,3-bis[(4-methoxybenzoyl)oxy]-, (2S,3S)- |
| (+)-Bis(4-methoxybenzoyl)-D-tartaric Acid |
| D-Di-p-methyloxyphenyl-tartaric acid |
| EINECS 471-150-6 |
| (2S,3S)-2,3-Bis[(4-methoxybenzoyl)oxy]succinic acid |
| MFCD07368366 |
| (+)-Di-p-anisoyl-D-tartaric Acid |
| (2S,3S)-2,3-Bis{[(4-methoxyphenyl)carbonyl]oxy}butanedioic acid |
| (2S,3S)-2,3-Bis((4-methoxybenzoyl)oxy)succinic acid |
