Introduction：Basic information about CAS 200422-18-0|4-Nitrophenylbeta-D-galactopyranoside, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Nitrophenylbeta-D-galactopyranoside |
|---|
| CAS Number | 200422-18-0 | Molecular Weight | 301.249 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 582.2±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H15NO8 | Melting Point | 180-184ºC |
|---|
| MSDS | Chinese | Flash Point | 305.9±30.1 °C |
|---|
Names
| Name | 4-Nitrophenyl β-D-galactopyranoside |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 582.2±50.0 °C at 760 mmHg |
|---|
| Melting Point | 180-184ºC |
|---|
| Molecular Formula | C12H15NO8 |
|---|
| Molecular Weight | 301.249 |
|---|
| Flash Point | 305.9±30.1 °C |
|---|
| Exact Mass | 301.079773 |
|---|
| PSA | 145.20000 |
|---|
| LogP | -0.55 |
|---|
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.648 |
|---|
| InChIKey | KSEGJDPERYLUSV-YOGPMPDXSA-N |
|---|
| SMILES | O.O=[N+]([O-])c1ccc(OC2OC(CO)C(O)C(O)C2O)cc1 |
|---|
Safety Information
| Safety Phrases | S22-S24/25 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| 4-Nitrophenyl β-D-galactopyranoside |
| (2R,3R,4S,5R,6S)-2-(Hydroxymethyl)-6-(4-nitrophenoxy)tetrahydro-2H-pyran-3,4,5-triol hydrate |
| MFCD00150725 |
| 4-Nitrophenyl beta-D-galactopyranoside |
| EINECS 221-584-5 |
| 1-O-[P-NITROPHENYL]-β-D-GALACTOPYRANOSE |
| β-D-Galactopyranoside, 4-nitrophenyl (9CI) |
| β-D-Galactopyranoside, 4-nitrophenyl |
| p-Nitrophenyl β-D-galactopyranoside |
