Introduction:Basic information about CAS 201856-53-3|(3R,4S)-1-Benzoyl-3-(1-ethoxyethoxy)-4-phenylazetidin-2-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (3R,4S)-1-Benzoyl-3-(1-ethoxyethoxy)-4-phenylazetidin-2-one |
|---|
| CAS Number | 201856-53-3 | Molecular Weight | 339.385 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 464.8±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H21NO4 | Melting Point | 1.22ºC |
|---|
| MSDS | / | Flash Point | 234.9±31.5 °C |
|---|
Names
| Name | (3R,4S)-1-Benzoyl-3-(1-ethoxyethoxy)-4-phenyl-2-azetidinone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 464.8±55.0 °C at 760 mmHg |
|---|
| Melting Point | 1.22ºC |
|---|
| Molecular Formula | C20H21NO4 |
|---|
| Molecular Weight | 339.385 |
|---|
| Flash Point | 234.9±31.5 °C |
|---|
| Exact Mass | 339.147064 |
|---|
| PSA | 55.84000 |
|---|
| LogP | 2.37 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.595 |
|---|
| InChIKey | XSYLUBKWRZCOQP-CXRLMVSZSA-N |
|---|
| SMILES | CCOC(C)OC1C(=O)N(C(=O)c2ccccc2)C1c1ccccc1 |
|---|
Synonyms
| cis-1-Phenyl-2-benzoylcyclopropan |
| (3R,4S)-1-Benzoyl-3-(1-ethoxyethoxy)-4-phenyl-2-azetidinone |
| rac.-cis-2-Phenyl-1-benzoyl-cyclopropan |
| cis-1-Benzoyl-2-phenyl-cyclohexan |
| 2-Azetidinone, 1-benzoyl-3-(1-ethoxyethoxy)-4-phenyl-, (3R,4S)- |
| Z-1-benzoyl-2-phenylcyclopropane |
| cis-1-benzoyl-2-phenylcyclopropane |
| (3R,4S)-1-Benzoyl-3-(1-ethoxyethoxy)-4-phenylazetidin-2-one |