Introduction：Basic information about CAS 40020-01-7|pyridafol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | pyridafol |
|---|
| CAS Number | 40020-01-7 | Molecular Weight | 206.62800 |
|---|
| Density | 1.35g/cm3 | Boiling Point | 315.3ºC at 760 mmHg |
|---|
| Molecular Formula | C10H7ClN2O | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 144.5ºC |
|---|
Names
| Name | pyridafol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.35g/cm3 |
|---|
| Boiling Point | 315.3ºC at 760 mmHg |
|---|
| Molecular Formula | C10H7ClN2O |
|---|
| Molecular Weight | 206.62800 |
|---|
| Flash Point | 144.5ºC |
|---|
| Exact Mass | 206.02500 |
|---|
| PSA | 46.01000 |
|---|
| LogP | 2.50260 |
|---|
| Index of Refraction | 1.641 |
|---|
| InChIKey | ZUSHSDOEVHPTCU-UHFFFAOYSA-N |
|---|
| SMILES | O=c1cc(Cl)[nH]nc1-c1ccccc1 |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2933990090 |
|---|
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| Pyridafol |
| Pyridafol [ISO] |
| 3-phenyl-4-hydroxy-6-chloropyridazine |
| 3-phenyl-4-hydroxy-6-chlorpyridazine |
| EINECS 254-752-1 |
| 6-chloro-3-phenyl-1H-pyridazin-4-one |
| 6-chloro-3-phenyl-4-pyridazinol |
| 6-Chloro-3-phenylpyridazin-4-ol |
| 3-Chloro-5-hydroxy-6-phenylpyridazine,6-Chloro-3-phenyl-4-pyridazinol |
| 6-chloro-3-phenylpyridazin-4-ol |
| CL 9673 |
