Introduction：Basic information about CAS 84777-06-0|1,2-Benzenedicarboxylic acid, dipentyl ester, branched and linear, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,2-Benzenedicarboxylic acid, dipentyl ester, branched and linear |
|---|
| CAS Number | 84777-06-0 | Molecular Weight | 304.38100 |
|---|
| Density | / | Boiling Point | 439.4ºC at 760 mmHg |
|---|
| Molecular Formula | C18H24O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 233.7ºC |
|---|
Names
| Name | 3,4-Bis(3-methylbutyl)phthalate |
|---|
Chemical & Physical Properties
| Boiling Point | 439.4ºC at 760 mmHg |
|---|
| Molecular Formula | C18H24O4 |
|---|
| Molecular Weight | 304.38100 |
|---|
| Flash Point | 233.7ºC |
|---|
| Exact Mass | 304.16700 |
|---|
| PSA | 80.26000 |
|---|
| LogP | 1.59080 |
|---|
| InChIKey | YRWFRHKQYQHUTP-UHFFFAOYSA-L |
|---|
| SMILES | CC(C)CCc1ccc(C(=O)[O-])c(C(=O)[O-])c1CCC(C)C |
|---|
