Introduction：Basic information about CAS 207511-17-9|6-Methoxypurine hemihydrate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Methoxypurine hemihydrate |
|---|
| CAS Number | 207511-17-9 | Molecular Weight | 168.15300 |
|---|
| Density | 1.55g/cm3 | Boiling Point | 233.4ºC at 760 mmHg |
|---|
| Molecular Formula | C6H8N4O2 | Melting Point | 196-198ºC |
|---|
| MSDS | / | Flash Point | 80ºC |
|---|
Names
| Name | 6-Methoxy-1H-purine hydrate (1:1) |
|---|
Chemical & Physical Properties
| Density | 1.55g/cm3 |
|---|
| Boiling Point | 233.4ºC at 760 mmHg |
|---|
| Melting Point | 196-198ºC |
|---|
| Molecular Formula | C6H8N4O2 |
|---|
| Molecular Weight | 168.15300 |
|---|
| Flash Point | 80ºC |
|---|
| Exact Mass | 168.06500 |
|---|
| PSA | 72.92000 |
|---|
| LogP | 0.29720 |
|---|
| Vapour Pressure | 0.0853mmHg at 25°C |
|---|
| Index of Refraction | 1.73 |
|---|
| InChIKey | OWMJVYIQFRCDEN-UHFFFAOYSA-N |
|---|
| SMILES | COc1ncnc2nc[nH]c12.COc1ncnc2nc[nH]c12.O |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | 22 |
|---|
| Safety Phrases | 26-36 |
|---|
