Introduction：Basic information about CAS 85677-93-6|Dehydro NiModipine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dehydro NiModipine |
|---|
| CAS Number | 85677-93-6 | Molecular Weight | 416.42400 |
|---|
| Density | 1.221±0.06 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C21H24N2O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Isopropyl 2-methoxyethyl 2,6-dimethyl-4-(3-nitrophenyl)-3,5-pyrid inedicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.221±0.06 g/cm3 |
|---|
| Molecular Formula | C21H24N2O7 |
|---|
| Molecular Weight | 416.42400 |
|---|
| Exact Mass | 416.15800 |
|---|
| PSA | 120.54000 |
|---|
| LogP | 4.16520 |
|---|
| InChIKey | SJJUCKCPGPCJQM-UHFFFAOYSA-N |
|---|
| SMILES | COCCOC(=O)c1c(C)nc(C)c(C(=O)OC(C)C)c1-c1cccc([N+](=O)[O-])c1 |
|---|
| Water Solubility | Practically insoluble (0.046 g/L) (25 ºC) |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| Nimodipine Oxidized |
| Dehydro NiModipine |
| 2,6-Dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylic acid 2-methoxyethyl 1-methylethyl ester |
| Nimodipine Impurity 1 |
