Introduction：Basic information about CAS 917251-86-6|8-Bromo-3-(trifluoromethyl)quinoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 8-Bromo-3-(trifluoromethyl)quinoline |
|---|
| CAS Number | 917251-86-6 | Molecular Weight | 276.053 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 301.3±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H5BrF3N | Melting Point | / |
|---|
| MSDS | / | Flash Point | 136.0±26.5 °C |
|---|
Names
| Name | 8-Bromo-3-(trifluoromethyl)quinoline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 301.3±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H5BrF3N |
|---|
| Molecular Weight | 276.053 |
|---|
| Flash Point | 136.0±26.5 °C |
|---|
| Exact Mass | 274.955750 |
|---|
| PSA | 12.89000 |
|---|
| LogP | 3.48 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.573 |
|---|
| InChIKey | AQBADHOMRVAOTB-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)c1cnc2c(Br)cccc2c1 |
|---|
Synonyms
| 8-Bromo-3-(trifluoromethyl)quinoline |
| y6499 |
| Quinoline, 8-bromo-3-(trifluoromethyl)- |
| 8-bromo-3-(trifluoromethyl)-quinoline |
