Introduction：Basic information about CAS 7077-34-1|2-[bis(2-nitrooxyethyl)amino]ethyl nitrate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[bis(2-nitrooxyethyl)amino]ethyl nitrate |
|---|
| CAS Number | 7077-34-1 | Molecular Weight | 284.18100 |
|---|
| Density | 1.478 g/cm3 | Boiling Point | 381.8ºC at 760 mmHg |
|---|
| Molecular Formula | C6H12N4O9 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 184.7ºC |
|---|
Names
| Name | 2-[bis(2-nitrooxyethyl)amino]ethyl nitrate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.478 g/cm3 |
|---|
| Boiling Point | 381.8ºC at 760 mmHg |
|---|
| Molecular Formula | C6H12N4O9 |
|---|
| Molecular Weight | 284.18100 |
|---|
| Flash Point | 184.7ºC |
|---|
| Exact Mass | 284.06000 |
|---|
| PSA | 168.39000 |
|---|
| LogP | 0.48290 |
|---|
| Index of Refraction | 1.503 |
|---|
| InChIKey | HWKQNAWCHQMZHK-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])OCCN(CCO[N+](=O)[O-])CCO[N+](=O)[O-] |
|---|
Safety Information
Synonyms
| Trolnitratum [INN-Latin] |
| Trolnitrate |
| 2,2',2''-Nitrilotriethylnitrat |
| Trolnitrate [INN] |
| 2,2',2''-Nitrilotriethanol trinitrate |
| tris-(2-nitryloxy-ethyl)-amine |
| Triethanolaminotrisalpetersaeureester |
| Triethanolamintrinitrat |
| 2,2',2''-Nitrilotrisethanol,trinitrate (ester) |
| Trolnitrato [INN-Spanish] |
| EINECS 230-376-3 |
| Tris-(2-nitryloxy-aethyl)-amin |
