Introduction：Basic information about CAS 7039-74-9|2-Bromo-1-(5-chloro-1-benzofuran-2-yl)ethanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Bromo-1-(5-chloro-1-benzofuran-2-yl)ethanone |
|---|
| CAS Number | 7039-74-9 | Molecular Weight | 273.51000 |
|---|
| Density | 1.677g/cm3 | Boiling Point | 340.8ºC at 760mmHg |
|---|
| Molecular Formula | C10H6BrClO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 159.9ºC |
|---|
Names
| Name | 2-Bromo-1-(5-chloro-1-benzofuran-2-yl)ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.677g/cm3 |
|---|
| Boiling Point | 340.8ºC at 760mmHg |
|---|
| Molecular Formula | C10H6BrClO2 |
|---|
| Molecular Weight | 273.51000 |
|---|
| Flash Point | 159.9ºC |
|---|
| Exact Mass | 271.92400 |
|---|
| PSA | 30.21000 |
|---|
| LogP | 3.66380 |
|---|
| Index of Refraction | 1.644 |
|---|
| InChIKey | VPUBAVYOQQLHPM-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CBr)c1cc2cc(Cl)ccc2o1 |
|---|
Synonyms
| 2-bromoacetyl-5-chlorobenzofuran |
| 2-Brom-1-(5-chlor-benzofuran-2-yl)-aethanon |
| 5-Chlor-2-bromacetyl-benzofuran |
| 2-bromo-1-(5-chloro-benzofuran-2-yl)-ethanone |
