Introduction：Basic information about CAS 914224-34-3|2-(4-Nitrophenyl)Benzo[D]Imidazo[2,1-B]Thiazol-7-Ol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-Nitrophenyl)Benzo[D]Imidazo[2,1-B]Thiazol-7-Ol |
|---|
| CAS Number | 914224-34-3 | Molecular Weight | 311.31500 |
|---|
| Density | 1.61g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C15H9N3O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-(4-Nitrophenyl)imidazo[2,1-b][1,3]benzothiazol-7-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.61g/cm3 |
|---|
| Molecular Formula | C15H9N3O3S |
|---|
| Molecular Weight | 311.31500 |
|---|
| Exact Mass | 311.03600 |
|---|
| PSA | 111.59000 |
|---|
| LogP | 4.35300 |
|---|
| Index of Refraction | 1.805 |
|---|
| InChIKey | FCKPMFCYLRAGSW-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(-c2cn3c(n2)sc2cc(O)ccc23)cc1 |
|---|
| Storage condition | 2-8°C |
|---|
Synonyms
| 2-<4-Nitro-phenyl>-7-aza-pyrimidazol |
| 2-(p-nitrophenyl)imidazo[1,2-a]pyrimidine |
| 2-p-Nitrophenyl-imidazo<1,2-a>pyrimidin |
| 2-(4-Nitro-phenyl)-imidazo[1,2-a]pyrimidin |
| 2-(4-nitrophenyl)imidazo[2,1-b]benzothiazol-7-ol |
| 2-(4-Nitro-phenyl)-imidazo[1,2-a] pyrimidine |
