CAS 156122-91-7|Chromoionophore XVII
Introduction：Basic information about CAS 156122-91-7|Chromoionophore XVII, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Chromoionophore XVII | ||
|---|---|---|---|
| CAS Number | 156122-91-7 | Molecular Weight | 474.54900 |
| Density | / | Boiling Point | / |
| Molecular Formula | C18H15KN2O7S2 | Melting Point | / |
| MSDS | ChineseUSA | Flash Point | / |
| Symbol | GHS07 | Signal Word | Warning |
Names
| Name | potassium,(4Z)-4-[[4-(2-hydroxyethylsulfonyl)phenyl]hydrazinylidene]-1-oxonaphthalene-2-sulfonate |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Molecular Formula | C18H15KN2O7S2 |
|---|---|
| Molecular Weight | 474.54900 |
| Exact Mass | 473.99600 |
| PSA | 173.28000 |
| LogP | 5.57330 |
| InChIKey | FEQBTLSWGJASRO-UHFFFAOYSA-M |
| SMILES | O=S(=O)([O-])c1cc(N=Nc2ccc(S(=O)(=O)CCO)cc2)c2ccccc2c1O.[K+] |
Safety Information
| Symbol | GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
Articles3
More Articles| G. Mohr, O. Wolfbeis Anal. Chim. Acta 292 , 41, (1994) | |
| G. Mohr Optical sensors for pH and cations using vinylsulfonyl dye chemistry | |
| Complexation of Cationic Species Crown Ethers; Inoue Cation Binding by Macrocycles , (1990), 465 |
Synonyms
| GJM-541 |
| 1-Hydroxy-4-[4-(2-hydroxyethylsulfonyl)phenylazo]naphthalene-2-sulfonic acid potassium salt |
| Chromoionophore XVII |
