Introduction：Basic information about CAS 192138-05-9|(R)-(+)-2,2'-Bis[di(3,5-di-t-butylphenyl)phosphino]-6,6'-dimethoxy-1,, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (R)-(+)-2,2'-Bis[di(3,5-di-t-butylphenyl)phosphino]-6,6'-dimethoxy-1,1'-biphenyl,min. |
|---|
| CAS Number | 192138-05-9 | Molecular Weight | 468.54900 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C31H34P2 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
Names
| Name | (3-Isopropylphenyl)(2'-{[3-(2-methyl-2-propanyl)phenyl]phosphino} -2-biphenylyl)phosphine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C31H34P2 |
|---|
| Molecular Weight | 468.54900 |
|---|
| Exact Mass | 468.21400 |
|---|
| PSA | 27.18000 |
|---|
| LogP | 7.03310 |
|---|
| Appearance of Characters | Powder | white |
|---|
| InChIKey | PBYRAYONARLAQJ-UHFFFAOYSA-N |
|---|
| SMILES | COc1cccc(P(c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c1-c1c(OC)cccc1P(c1cc(C(C)(C)C)cc(C(C)(C)C)c1)c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xi |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| rac (2,3-Dimethoxyphenyl)-4-piperidinemethanol |
| (2,3-dimethoxyphenyl)-(piperidin-4-yl)-methanol |
| (R)-(+)-(6,6'-dimethoxybiphenyl-2,2'-diyl)bis(3,5-di-tert-butylphenylphosphine) |
| (R)-(6,6'-dimethoxybiphenyl-2,2'-diyl)bis(bis(3,5-di-tert-butylphenyl)phosphine) |
| MFCD09753001 |
| (6,6'-dimethoxybiphenyl-2,2'-diyl)bis(3,5-di-tert-butylphenylphosphine) |
| 4-[1-hydroxy-1-(2,3-dimethoxyphenyl)methyl]piperidine |
| (R)-(+)-(2,3-dimethoxyphenyl)(piperidin-4-yl)metanol |
