Introduction：Basic information about CAS 57663-18-0|Methyl 2-methyl-1H-indole-5-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 2-methyl-1H-indole-5-carboxylate |
|---|
| CAS Number | 57663-18-0 | Molecular Weight | 189.210 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 341.9±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H11NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 160.6±22.3 °C |
|---|
Names
| Name | Methyl 2-methyl-1H-indole-5-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 341.9±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H11NO2 |
|---|
| Molecular Weight | 189.210 |
|---|
| Flash Point | 160.6±22.3 °C |
|---|
| Exact Mass | 189.078979 |
|---|
| PSA | 42.09000 |
|---|
| LogP | 3.04 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.624 |
|---|
| InChIKey | WBTQQYISPCCLIS-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1ccc2[nH]c(C)cc2c1 |
|---|
Synonyms
| 3-Carboxy-2-methyl-indol |
| 2-methyl-indole-5-carboxylic acid methyl ester |
| 2-Methyl-indol-3-carbonsaeure |
| Methyl 2-methyl-1H-indole-5-carboxylate |
| 2-methyl-1H-indole-5-carboxylic acid methyl ester |
| 1H-Indole-5-carboxylic acid, 2-methyl-, methyl ester |
| methyl 2-methylindole-5-carboxylate |
| 2-methyl-indole-3-carboxylic acid |
