Introduction：Basic information about CAS 732982-66-0|Benzonitrile, 3-[(1S,2S)-2-amino-1-[(4-chlorophenyl)methyl]propyl]-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzonitrile, 3-[(1S,2S)-2-amino-1-[(4-chlorophenyl)methyl]propyl]- |
|---|
| CAS Number | 732982-66-0 | Molecular Weight | 284.78300 |
|---|
| Density | 1.179g/cm3 | Boiling Point | 402.54ºC at 760 mmHg |
|---|
| Molecular Formula | C17H17ClN2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Benzonitrile, 3-[(1S,2S)-2-amino-1-[(4-chlorophenyl)methyl]propyl] |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.179g/cm3 |
|---|
| Boiling Point | 402.54ºC at 760 mmHg |
|---|
| Molecular Formula | C17H17ClN2 |
|---|
| Molecular Weight | 284.78300 |
|---|
| Exact Mass | 284.10800 |
|---|
| PSA | 49.81000 |
|---|
| LogP | 4.58548 |
|---|
| Index of Refraction | 1.603 |
|---|
| InChIKey | DUGNQLMMMIZIFR-YVEFUNNKSA-N |
|---|
| SMILES | CC(N)C(Cc1ccc(Cl)cc1)c1cccc(C#N)c1 |
|---|
Synonyms
| N-(1S,2S)-[3-(4-chlorophenyl)-2-(3-cyanophenyl)-1-methylpropyl]amine |
| 3-((2S,3S)-3-amino-1-(4-chlorophenyl)butan-2-yl)benzonitrile |
| 2S)-2-aMino-1-[(4-chlorophenyl)Methyl]propyl] |
| N-[3-(4-chlorophenyl)-2(S)-(3-cyanophenyl)-1(S)-methylpropyl]amine |
| N-(1S,2S)-[2-(3-cyanophenyl)-3-(4-chlorophenyl)-1-methylpropyl]amine |
| 3-[(1S |
| 3-(4-chlorophenyl)-2(S)-(3-cyanophenyl)-1(S)-methyl-propylamine |
