Introduction：Basic information about CAS 152015-93-5|3-(4-tert-butylphenyl)-2,5-diphenyl-3,4-dihydropyrazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(4-tert-butylphenyl)-2,5-diphenyl-3,4-dihydropyrazole |
|---|
| CAS Number | 152015-93-5 | Molecular Weight | 354.48700 |
|---|
| Density | 1.04g/cm3 | Boiling Point | 493ºC at 760mmHg |
|---|
| Molecular Formula | C25H26N2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 252ºC |
|---|
Names
| Name | 3-(4-tert-butylphenyl)-2,5-diphenyl-3,4-dihydropyrazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.04g/cm3 |
|---|
| Boiling Point | 493ºC at 760mmHg |
|---|
| Molecular Formula | C25H26N2 |
|---|
| Molecular Weight | 354.48700 |
|---|
| Flash Point | 252ºC |
|---|
| Exact Mass | 354.21000 |
|---|
| PSA | 15.60000 |
|---|
| LogP | 5.84040 |
|---|
| Vapour Pressure | 7.31E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.59 |
|---|
| InChIKey | IVEQKIQHNZNLLP-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1ccc(C2CC(c3ccccc3)=NN2c2ccccc2)cc1 |
|---|
Synonyms
| 1,3-diphenyl-5-(4-tert-butylphenyl)pyrazoline |
| 5-(4-Butylphenyl)-1,3-phenylpyrazoline |
