Introduction:Basic information about CAS 70916-89-1|METHYL 4'-FORMYL-[1,1'-BIPHENYL]-4-CARBOXYLATE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | METHYL 4'-FORMYL-[1,1'-BIPHENYL]-4-CARBOXYLATE |
|---|
| CAS Number | 70916-89-1 | Molecular Weight | 240.25400 |
|---|
| Density | 1.176g/cm3 | Boiling Point | 398.1ºC at 760 mmHg |
|---|
| Molecular Formula | C15H12O3 | Melting Point | 112-116ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 177.9ºC |
|---|
| Symbol | GHS05, GHS07, GHS09 | Signal Word | Danger |
|---|
Names
| Name | methyl 4-(4-formylphenyl)benzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.176g/cm3 |
|---|
| Boiling Point | 398.1ºC at 760 mmHg |
|---|
| Melting Point | 112-116ºC |
|---|
| Molecular Formula | C15H12O3 |
|---|
| Molecular Weight | 240.25400 |
|---|
| Flash Point | 177.9ºC |
|---|
| Exact Mass | 240.07900 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 2.95270 |
|---|
| Index of Refraction | 1.594 |
|---|
| InChIKey | URINKTWOCVLGGR-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1ccc(-c2ccc(C=O)cc2)cc1 |
|---|
Safety Information
| Symbol | GHS05, GHS07, GHS09 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H315-H318-H335-H400 |
|---|
| Precautionary Statements | P261-P273-P280-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi,N |
|---|
| Risk Phrases | R37/38 |
|---|
| Safety Phrases | 26-36/37/39-60-61 |
|---|
| RIDADR | UN 3077 9/PG 3 |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 4'-Formyl-biphenyl-4-carbonsaeuremethylester |
| 4'-Formyl-[1,1'-Biphenyl]-4-carboxylic Acid Methyl Ester |
| 4-methoxycarbonyl-4'-formyl-1,1'-biphenyl |
| MFCD04039123 |
| Methyl 4'-formyl[1,1'-biphenyl]-4-carboxylate |
| methyl 4'-formylbiphenyl-4-carboxylate |
| 4-(4-(CO2Me)C6H4)C6H4CHO |
| 4'-Formylbiphenyl-4-carboxylic acid methyl ester |