Introduction：Basic information about CAS 14541-93-6|6-nitro-benzooxazole-2-thiol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-nitro-benzooxazole-2-thiol |
|---|
| CAS Number | 14541-93-6 | Molecular Weight | 196.18300 |
|---|
| Density | 1.65 g/cm3 | Boiling Point | 337.4ºCat 760 mmHg |
|---|
| Molecular Formula | C7H4N2O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 157.9ºC |
|---|
Names
| Name | 6-nitro-3H-1,3-benzoxazole-2-thione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.65 g/cm3 |
|---|
| Boiling Point | 337.4ºCat 760 mmHg |
|---|
| Molecular Formula | C7H4N2O3S |
|---|
| Molecular Weight | 196.18300 |
|---|
| Flash Point | 157.9ºC |
|---|
| Exact Mass | 195.99400 |
|---|
| PSA | 110.65000 |
|---|
| LogP | 2.54790 |
|---|
| Vapour Pressure | 0.000105mmHg at 25°C |
|---|
| Index of Refraction | 1.741 |
|---|
| InChIKey | GCVNWXZRBBCASB-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc2[nH]c(=S)oc2c1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 6-Nitro-benzooxazole-2-thiol |
| 6-Nitro-3H-benzoxazol-2-thion |
| 6-Nitro-2-benzoxazolethiol |
| 6-Nitro-2-benzoxazolinthion |
| 2-Mercapto-6-nitrobenzoxazole |
| 6-nitro-3H-benzooxazole-2-thione |
| 6-nitro-3H-benzoxazole-2-thione |
| MFCD02725449 |
| 6-Nitro-benzoxazolthion |
