Introduction：Basic information about CAS 1219805-29-4|2-(3-Benzoylphenyl)(2H4)propanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(3-Benzoylphenyl)(2H4)propanoic acid |
|---|
| CAS Number | 1219805-29-4 | Molecular Weight | 258.305 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 431.3±28.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H10D4O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 228.8±20.5 °C |
|---|
Names
| Name | 2-(3-benzoylphenyl)-2,3,3,3-tetradeuteriopropanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 431.3±28.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H10D4O3 |
|---|
| Molecular Weight | 258.305 |
|---|
| Flash Point | 228.8±20.5 °C |
|---|
| Exact Mass | 258.119415 |
|---|
| PSA | 54.37000 |
|---|
| LogP | 2.81 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.592 |
|---|
| InChIKey | DKYWVDODHFEZIM-RRRGEQHMSA-N |
|---|
| SMILES | CC(C(=O)O)c1cccc(C(=O)c2ccccc2)c1 |
|---|
Synonyms
| [2H4]-Ketoprofen |
| Benzeneacetic-d acid, 3-benzoyl-α-(methyl-d)- |
| 2-(3-Benzoylphenyl)(H)propanoic acid |
