Introduction：Basic information about CAS 902494-31-9|tert-butyl N-[1-(trifluoromethyl)cyclopropyl]carbamate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-butyl N-[1-(trifluoromethyl)cyclopropyl]carbamate |
|---|
| CAS Number | 902494-31-9 | Molecular Weight | 225.20800 |
|---|
| Density | 1.206g/cm3 | Boiling Point | 228.006ºC at 760 mmHg |
|---|
| Molecular Formula | C9H14F3NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 91.695ºC |
|---|
Names
| Name | tert-butyl N-[1-(trifluoromethyl)cyclopropyl]carbamate |
|---|
Chemical & Physical Properties
| Density | 1.206g/cm3 |
|---|
| Boiling Point | 228.006ºC at 760 mmHg |
|---|
| Molecular Formula | C9H14F3NO2 |
|---|
| Molecular Weight | 225.20800 |
|---|
| Flash Point | 91.695ºC |
|---|
| Exact Mass | 225.09800 |
|---|
| PSA | 38.33000 |
|---|
| LogP | 2.99690 |
|---|
| Index of Refraction | 1.423 |
|---|
| InChIKey | GHEKGGDYVHWSBM-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC1(C(F)(F)F)CC1 |
|---|
