Introduction:Basic information about CAS 80301-64-0|N,N-bis(2-ethylhexyl)-1H-benzotriazole-1-methylamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N,N-bis(2-ethylhexyl)-1H-benzotriazole-1-methylamine |
|---|
| CAS Number | 80301-64-0 | Molecular Weight | 372.59100 |
|---|
| Density | 0.99g/cm3 | Boiling Point | 481ºC at 760 mmHg |
|---|
| Molecular Formula | C23H40N4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 244.7ºC |
|---|
Names
| Name | N-(benzotriazol-1-ylmethyl)-2-ethyl-N-(2-ethylhexyl)hexan-1-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.99g/cm3 |
|---|
| Boiling Point | 481ºC at 760 mmHg |
|---|
| Molecular Formula | C23H40N4 |
|---|
| Molecular Weight | 372.59100 |
|---|
| Flash Point | 244.7ºC |
|---|
| Exact Mass | 372.32500 |
|---|
| PSA | 33.95000 |
|---|
| LogP | 6.12360 |
|---|
| Index of Refraction | 1.537 |
|---|
| InChIKey | OKQVTLCUHATGDD-UHFFFAOYSA-N |
|---|
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)Cn1nnc2ccccc21 |
|---|
Synonyms
| 1-H-Benzotriazole-1-methamine,N,N-di-2-ethylhexyl |
| EINECS 279-446-5 |
| N-(1H-benzotriazol-1-ylmethyl)-2-ethyl-N-(2-ethylhexyl)hexan-1-amine |
| 1H-Benzotriazole-1-methanamine,N,N-bis(2-ethylhexyl) |
| N,N-Bis(2-ethylhexyl)-1H-benzotriazole-1-methylamine |