Introduction：Basic information about CAS 80369-11-5|2-(2-Oxobutyl)-1H-isoindole-1,3(2H)-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(2-Oxobutyl)-1H-isoindole-1,3(2H)-dione |
|---|
| CAS Number | 80369-11-5 | Molecular Weight | 217.221 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 353.0±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H11NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 159.5±15.5 °C |
|---|
Names
| Name | 2-(2-oxobutyl)isoindole-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 353.0±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H11NO3 |
|---|
| Molecular Weight | 217.221 |
|---|
| Flash Point | 159.5±15.5 °C |
|---|
| Exact Mass | 217.073898 |
|---|
| PSA | 54.45000 |
|---|
| LogP | 1.85 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.575 |
|---|
| InChIKey | MFUXDGJPAGYNDT-UHFFFAOYSA-N |
|---|
| SMILES | CCC(=O)CN1C(=O)c2ccccc2C1=O |
|---|
Synonyms
| N-(2-Oxo-butyl)-phthalimid |
| 1-phtalimido-2-butanone |
| 2-(2-Oxobutyl)-1H-isoindole-1,3(2H)-dione |
| 1H-Isoindole-1,3(2H)-dione,2-(2-oxobutyl) |
| 2-(2-oxobutyl)isoindoline-1,3-dione |
| 1-N-phthalimidobutan-2-one |
| QC-4751 |
| 1H-Isoindole-1,3(2H)-dione, 2-(2-oxobutyl)- |
| N-(2-oxo-butyl)-phthalimide |
| 1-phthalimidobutan-2-one |
| N-(oxobutyl)-phthalimide |
