Introduction:Basic information about CAS 26315-61-7|(1R)-(-)-Menthyl glyoxylate hydrate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (1R)-(-)-Menthyl glyoxylate hydrate |
|---|
| CAS Number | 26315-61-7 | Molecular Weight | 230.301 |
|---|
| Density | 1,182 g/cm3 | Boiling Point | 95-96°C 0,3mm |
|---|
| Molecular Formula | C12H22O4 | Melting Point | 76-78°C |
|---|
| MSDS | / | Flash Point | 95-96°C/0.3mm |
|---|
Names
| Name | (1R)-(-)-Menthyl glyoxylate hydrate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1,182 g/cm3 |
|---|
| Boiling Point | 95-96°C 0,3mm |
|---|
| Melting Point | 76-78°C |
|---|
| Molecular Formula | C12H22O4 |
|---|
| Molecular Weight | 230.301 |
|---|
| Flash Point | 95-96°C/0.3mm |
|---|
| Exact Mass | 230.151810 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 2.12500 |
|---|
| Vapour Pressure | 0.00344mmHg at 25°C |
|---|
| Index of Refraction | 1.458 |
|---|
| InChIKey | YNUVAJRGRQBLLB-UHFFFAOYSA-N |
|---|
| SMILES | CC1CCC(C(C)C)C(OC(=O)C=O)C1 |
|---|
| Storage condition | 2-8℃ |
|---|
Safety Information
| Risk Phrases | R51/53 |
|---|
| Safety Phrases | S61 |
|---|
| RIDADR | 3077 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 9 |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| MFCD00792503 |
| l-menthyl glyoxylate |
| (1R,2S,5R)-2-Isopropyl-5-methylcyclohexyl oxoacetate hydrate (1:1) |
| Acetic acid, 2-oxo-, (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl ester, hydrate (1:1) |