Introduction：Basic information about CAS 38686-38-3|Chloro(methyldiphenylphosphine)gold(I),95, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Chloro(methyldiphenylphosphine)gold(I),95 |
|---|
| CAS Number | 38686-38-3 | Molecular Weight | 432.63600 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C13H13AuClP | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | chlorogold,methyl(diphenyl)phosphane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C13H13AuClP |
|---|
| Molecular Weight | 432.63600 |
|---|
| Exact Mass | 432.01100 |
|---|
| PSA | 13.59000 |
|---|
| InChIKey | CAOYFWWUVVBZOV-UHFFFAOYSA-M |
|---|
| SMILES | CP(c1ccccc1)c1ccccc1.Cl[Au] |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| (methyldiphenylphosphine)AuCl |
| AuCl(PMePh2) |
| [Au(Cl)(PPh2Me)] |
| Chloro(methyldiphenylphosphine)gold(I) |
| (diphenylmethylphosphine)AuCl |
| (methyldiphenylphosphine)gold(I) chloride |
| (methyldiphenylphosphine)(Cl)gold(I) |
