Introduction：Basic information about CAS 117-47-5|diethyl (1-methylbutyl)malonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | diethyl (1-methylbutyl)malonate |
|---|
| CAS Number | 117-47-5 | Molecular Weight | 230.30100 |
|---|
| Density | 0,97 g/cm3 | Boiling Point | 118-119°C 9mm |
|---|
| Molecular Formula | C12H22O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 118-119°C/9mm |
|---|
Names
| Name | diethyl 2-pentan-2-ylpropanedioate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0,97 g/cm3 |
|---|
| Boiling Point | 118-119°C 9mm |
|---|
| Molecular Formula | C12H22O4 |
|---|
| Molecular Weight | 230.30100 |
|---|
| Flash Point | 118-119°C/9mm |
|---|
| Exact Mass | 230.15200 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 2.16500 |
|---|
| Vapour Pressure | 0.0192mmHg at 25°C |
|---|
| Index of Refraction | 1.4270 |
|---|
| InChIKey | RQFSNEWORATSCC-UHFFFAOYSA-N |
|---|
| SMILES | CCCC(C)C(C(=O)OCC)C(=O)OCC |
|---|
Safety Information
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| HS Code | 2917190090 |
|---|
Customs
| HS Code | 2917190090 |
|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 1-Methylbutyl malonic ester |
| Diethyl 1-Methylbutylmalonate |
| 1-Methylbutylmalonic Acid Diethyl Ester |
| diethyl pent-2-enylmalonate |
| EINECS 204-193-4 |
| diethyl pentan-2-ylmalonate |
| MFCD00051558 |
