Introduction:Basic information about CAS 91-30-5|4-Aminodiphenylamine-2-Sulfonic Acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Aminodiphenylamine-2-Sulfonic Acid |
|---|
| CAS Number | 91-30-5 | Molecular Weight | 264.300 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C12H12N2O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 5-amino-2-anilinobenzenesulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Molecular Formula | C12H12N2O3S |
|---|
| Molecular Weight | 264.300 |
|---|
| Exact Mass | 264.056854 |
|---|
| PSA | 100.80000 |
|---|
| LogP | 0.19 |
|---|
| Index of Refraction | 1.691 |
|---|
| InChIKey | HYLOSPCJTPLXSF-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc(Nc2ccccc2)c(S(=O)(=O)O)c1 |
|---|
Safety Information
| Hazard Codes | T,N |
|---|
| Risk Phrases | R22:Harmful if swallowed. R23:Toxic by inhalation. R50/53:Very Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment . |
|---|
| Safety Phrases | S45-S60-S61 |
|---|
| RIDADR | UN2811 6.1/PG 2 |
|---|
| HS Code | 2921590090 |
|---|
Customs
| HS Code | 2921590090 |
|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Benzenesulfonic acid, 5-amino-2-(phenylamino)- |
| Nerolsaeure |
| EINECS 202-058-4 |
| 5-Amino-2-anilinebenzenesulphonic acid |
| N-Phenyl-p-phenylenediaminesulfonic acid |
| 5-amino-2-anilino-benzenesulfonic acid |
| Metanilic acid,6-anilino |
| 6-Anilinometanilic acid |
| 4-Aminodiphenylamine-2-Sulfonic Acid |
| 5-amino-2-(phenylamino)benzenesulfonic acid |
| MFCD00035932 |
| 5-Amino-2-anilinobenzenesulfonic acid |
| 4-Amino-2-sulfodiphenylamine |
| 5-Amino-2-anilino-benzolsulfonsaeure |
| 4-Aminodiphenyamine-2-sulfonic acid |
| 4-Amino-diphenylamin-2-sulfonsaeure |