Introduction:Basic information about CAS 19433-93-3|4-Acetylamino-2-(diethylamino)anisole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Acetylamino-2-(diethylamino)anisole |
|---|
| CAS Number | 19433-93-3 | Molecular Weight | 236.31000 |
|---|
| Density | 1.086 g/cm3 | Boiling Point | 389.5ºC at 760 mmHg |
|---|
| Molecular Formula | C13H20N2O2 | Melting Point | 93-97 °C(lit.) |
|---|
| MSDS | / | Flash Point | 189.3ºC |
|---|
Names
| Name | N-[3-(diethylamino)-4-methoxyphenyl]acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.086 g/cm3 |
|---|
| Boiling Point | 389.5ºC at 760 mmHg |
|---|
| Melting Point | 93-97 °C(lit.) |
|---|
| Molecular Formula | C13H20N2O2 |
|---|
| Molecular Weight | 236.31000 |
|---|
| Flash Point | 189.3ºC |
|---|
| Exact Mass | 236.15200 |
|---|
| PSA | 41.57000 |
|---|
| LogP | 2.57280 |
|---|
| Vapour Pressure | 2.85E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.564 |
|---|
| InChIKey | BTJCIVXKBILNPY-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)c1cc(NC(C)=O)ccc1OC |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2-methoxy-5-acetylamino-N,N-diethylaniline |
| EINECS 243-058-4 |
| 2-methoxy-5-acetamido-N,N-diethylaniline |
| 5-acetylamino-2-methoxy-N,N-diethylaniline |
| 3-acetylamino-6-methoxy-N,N-diethylaniline |
| MFCD01075759 |
| 3-(N,N'-Diethyl)Amino-4-Methoxy Acetanilide |
| 2-Animo-4-cresol |
| 3-N,N-Diethylamino-4-methoxyacetanilide |
| 3-N,N-diethyl-4-methoxyacetanilide |