Introduction：Basic information about CAS 855785-77-2|Pyridinium, 1-(4-sulfobutyl)-, 4-methylbenzenesulfonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Pyridinium, 1-(4-sulfobutyl)-, 4-methylbenzenesulfonate |
|---|
| CAS Number | 855785-77-2 | Molecular Weight | 216.27700 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C9H14NO3S+ | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Pyridinium, 1-(4-sulfobutyl)-, 4-methylbenzenesulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C9H14NO3S+ |
|---|
| Molecular Weight | 216.27700 |
|---|
| Exact Mass | 216.06900 |
|---|
| PSA | 66.63000 |
|---|
| LogP | 1.72290 |
|---|
| InChIKey | QOVRISNMAUWIGC-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1.O=S(=O)(O)CCCC[n+]1ccccc1 |
|---|
Synonyms
| Pyridinium, 1-(4-sulfobutyl)-, salt with 4-methylbenzenesulfonic acid |
| N-butylsulfonate Pyridinium tosylate |
