Introduction:Basic information about CAS 704-14-3|5-Methoxy-2-nitrophenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Methoxy-2-nitrophenol |
|---|
| CAS Number | 704-14-3 | Molecular Weight | 169.135 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 297.4±20.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H7NO4 | Melting Point | 92-94 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 133.7±21.8 °C |
|---|
| Symbol | GHS05, GHS07 | Signal Word | Danger |
|---|
Names
| Name | 5-methoxy-2-nitrophenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 297.4±20.0 °C at 760 mmHg |
|---|
| Melting Point | 92-94 °C(lit.) |
|---|
| Molecular Formula | C7H7NO4 |
|---|
| Molecular Weight | 169.135 |
|---|
| Flash Point | 133.7±21.8 °C |
|---|
| Exact Mass | 169.037506 |
|---|
| PSA | 75.28000 |
|---|
| LogP | 1.91 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.583 |
|---|
| InChIKey | NRTULWPODYLFOJ-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc([N+](=O)[O-])c(O)c1 |
|---|
Safety Information
| Symbol | GHS05, GHS07 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H315-H318-H335 |
|---|
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 37/38-41-36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2909500000 |
|---|
Customs
| HS Code | 2909500000 |
|---|
| Summary | 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| Methyl-(4-nitro-3-hydroxy-phenyl)-aether |
| 5-Methoxy-2-nitrophenol |
| 5-methoxy-2-nitro-phenol |
| 2-hydroxy-4-methoxynitrobenzene |
| 3-methoxy-6-nitro-phenol |
| MFCD00100932 |
| Phenol, 5-methoxy-2-nitro- |
| 2-nitro-5-methoxyphenol |
| 3-Hydroxy-4-nitroanisole |