Introduction:Basic information about CAS 20330-45-4|4'-(tert-butyl)acetanilide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4'-(tert-butyl)acetanilide |
|---|
| CAS Number | 20330-45-4 | Molecular Weight | 191.26900 |
|---|
| Density | 1.01g/cm3 | Boiling Point | 333.1ºC at 760mmHg |
|---|
| Molecular Formula | C12H17NO | Melting Point | 168-170°C |
|---|
| MSDS | / | Flash Point | 198.5ºC |
|---|
Names
| Name | N-(4-tert-butylphenyl)acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.01g/cm3 |
|---|
| Boiling Point | 333.1ºC at 760mmHg |
|---|
| Melting Point | 168-170°C |
|---|
| Molecular Formula | C12H17NO |
|---|
| Molecular Weight | 191.26900 |
|---|
| Flash Point | 198.5ºC |
|---|
| Exact Mass | 191.13100 |
|---|
| PSA | 29.10000 |
|---|
| LogP | 3.01550 |
|---|
| Vapour Pressure | 0.000139mmHg at 25°C |
|---|
| Index of Refraction | 1.535 |
|---|
| InChIKey | RMUYDDKCUZHVHY-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Nc1ccc(C(C)(C)C)cc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Acetanilide,4'-tert-butyl |
| N-(4-(tert-Butyl)phenyl)acetamide |
| N-[4-(tert-butyl)phenyl]acetamide |
| 4-tert-butylphenylacetanilide |
| N-(4-t-butylphenyl)acetamide |
| p-tert-Butylacetanilide |
| N-[4-(1,1-Dimethylethyl)Phenyl]-Acetamide |
| Acetamide,N-[4-(1,1-dimethylethyl)phenyl] |
| 4'-(tert-Butyl)acetanilide |
| MFCD00043734 |
| 4-t-butylacetanilide |