Introduction:Basic information about CAS 38939-88-7|3-Chloro-4-nitrotoluene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Chloro-4-nitrotoluene |
|---|
| CAS Number | 38939-88-7 | Molecular Weight | 171.581 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 273.4±20.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H6ClNO2 | Melting Point | 24-28 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 119.1±21.8 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 3-Chloro-4-nitrotoluene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 273.4±20.0 °C at 760 mmHg |
|---|
| Melting Point | 24-28 °C(lit.) |
|---|
| Molecular Formula | C7H6ClNO2 |
|---|
| Molecular Weight | 171.581 |
|---|
| Flash Point | 119.1±21.8 °C |
|---|
| Exact Mass | 171.008713 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 2.80 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.570 |
|---|
| InChIKey | KGSQRFPDZCBVBS-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc([N+](=O)[O-])c(Cl)c1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn:Harmful; |
|---|
| Risk Phrases | R20/21/22;R36/37/38 |
|---|
| Safety Phrases | S36/37/39-S26-S61 |
|---|
| RIDADR | UN 3457 6.1/PG 3 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2904909090 |
|---|
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 1-chloro-5-methyl-2-nitroaniline |
| 1-Nitro-2-chloro-4-methylbenzene |
| 3-Chloro-4-nitrotolue |
| Benzene, 2-chloro-4-methyl-1-nitro- |
| 1-Chloro-2-nitro-5-methylbenzene |
| 4-methyl-2-nitrochlorobenzene |
| 3-Chloro-4-nitrotoluene |
| 3-chloro-4-Nitrotoluol |
| 2-chloro-4-methylnitrobenzene |
| 2-Chloro-4-methyl-1-nitrobenzene |
| EINECS 254-199-6 |
| MFCD02683043 |
| 5-Methyl-2-nitrochlorobenzene |
| 1-Chloro-5-methyl-2-nitrobenzene |