Introduction：Basic information about CAS 14128-84-8|copper(ii) benzoylacetonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | copper(ii) benzoylacetonate |
|---|
| CAS Number | 14128-84-8 | Molecular Weight | 385.90100 |
|---|
| Density | / | Boiling Point | 135ºC/0.25mmHg |
|---|
| Molecular Formula | C20H18CuO4 | Melting Point | 196ºC |
|---|
| MSDS | / | Flash Point | 133.7ºC |
|---|
Names
| Name | copper,(Z)-3-oxo-1-phenylbut-1-en-1-olate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 135ºC/0.25mmHg |
|---|
| Melting Point | 196ºC |
|---|
| Molecular Formula | C20H18CuO4 |
|---|
| Molecular Weight | 385.90100 |
|---|
| Flash Point | 133.7ºC |
|---|
| Exact Mass | 385.05000 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 4.50550 |
|---|
| Vapour Pressure | 0.000184mmHg at 25°C |
|---|
| InChIKey | IIPJCJBKVVFLHI-UHFFFAOYSA-L |
|---|
| SMILES | CC(=O)C=C([O-])c1ccccc1.CC(=O)C=C([O-])c1ccccc1.[Cu+2] |
|---|
Safety Information
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| Copper,bis(1-phenyl-1,3-butanedionato-kappaO,kappaO') |
| Copper,bis(1-phenyl-1,3-butanedionato-kappaO1,kappaO3) |
| MFCD00041717 |
| copper (Z)-3-oxo-1-phenylbut-1-en-1-olate |
| bis-benzoylacetonato copper |
