Introduction：Basic information about CAS 15483-58-6|Ac-Ala-Ala-Ala-Ala-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ac-Ala-Ala-Ala-Ala-OH |
|---|
| CAS Number | 15483-58-6 | Molecular Weight | 344.36400 |
|---|
| Density | 1.232g/cm3 | Boiling Point | 807.4ºC at 760mmHg |
|---|
| Molecular Formula | C14H24N4O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 442.1ºC |
|---|
Names
| Name | 2-[2-[2-(2-acetamidopropanoylamino)propanoylamino]propanoylamino]propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.232g/cm3 |
|---|
| Boiling Point | 807.4ºC at 760mmHg |
|---|
| Molecular Formula | C14H24N4O6 |
|---|
| Molecular Weight | 344.36400 |
|---|
| Flash Point | 442.1ºC |
|---|
| Exact Mass | 344.17000 |
|---|
| PSA | 153.70000 |
|---|
| Vapour Pressure | 1.19E-28mmHg at 25°C |
|---|
| Index of Refraction | 1.504 |
|---|
| InChIKey | YYZJRQOAVRANIE-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)NC(C)C(=O)NC(C)C(=O)NC(C)C(=O)NC(C)C(=O)O |
|---|
Synonyms
| Ac-(Ala)4-OH |
| Acetylalanyl-alanyl-alanyl-alanine |
| Ac-Ala-ala-ala-ala |
| L-Alanine,N-(N-(N-(N-acetyl-L-alanyl)-L-alanyl)-L-alanyl) |
| Acetyl-L-alanyl-L-alanyl-L-alanyl-L-alanine |
