Introduction:Basic information about CAS 86044-76-0|D-Ala10-LHRH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | D-Ala10-LHRH |
|---|
| CAS Number | 86044-76-0 | Molecular Weight | 1457.079 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C71H94ClN19O13 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Actcaa-LHRH |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Molecular Formula | C71H94ClN19O13 |
|---|
| Molecular Weight | 1457.079 |
|---|
| Exact Mass | 1455.696655 |
|---|
| PSA | 521.14000 |
|---|
| LogP | 1.35 |
|---|
| Index of Refraction | 1.690 |
|---|
| InChIKey | RXEFQWSRPHNLBJ-JHOBKTHQSA-N |
|---|
| SMILES | CC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(=O)C(C)NC(=O)C1CCCN1C(=O)C(CCCNC(=N)N)NC(=O)C(CC(C)C)NC(=O)C(CCCNC(=N)N)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CO)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)Cc1ccc(Cl)cc1 |
|---|
Synonyms
| N-D-pantothenoyl-2-aminoethanol |
| D-Pantothensaeure-(2-hydroxy-aethylamid) |
| Ac-D-Trp1,3 |
| D-Arg6-LH-RH |
| D-pantothenic acid-(2-hydroxy-ethylamide) |
| D-Alaninamide, 4-chloro-D-phenylalanyl-D-tryptophyl-L-seryl-L-tyrosyl-D-arginyl-L-leucyl-L-arginyl-L-prolyl-N-[(2R)-2-(acetylamino)-3-(1H-indol-3-yl)-1-oxopropyl]- |
| N-Hydroxyethyl pantothenamide |
| N-(2-hydroxy-ethyl) pantothenamide |
| D-Oxypantethein |
| Butanamide,2,4-dihydroxy-N-(3-((2-hydroxyethyl)amino)-3-oxopropyl)-3,3-dimethyl |
| 4-Chloro-D-phenylalanyl-D-tryptophyl-L-seryl-L-tyrosyl-D-arginyl-L-leucyl-L-arginyl-L-prolyl-N-[(2R)-2-acetamido-3-(1H-indol-3-yl)propanoyl]-D-alaninamide |
| N-(2-Hydroxyethyl)-3-((2,4-dihydroxy-3,3-dimethylbutanoyl)amino)propanamide |
| Pantothenamide MEA |
| D-p-Cl-Phe2 |
| Pantothenamide monoethanolamide |
| Butyramide,2,4-dihydroxy-N-(2-(2-hydroxyethylcarbamoyl)ethyl)-3,3-dimethyl |
| D-Ala10-LHRH |