Introduction：Basic information about CAS 3027-05-2|1,4-diacetylpiperazine-2,5-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,4-diacetylpiperazine-2,5-dione |
|---|
| CAS Number | 3027-05-2 | Molecular Weight | 198.176 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 424.4±38.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H10N2O4 | Melting Point | 99-100ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 216.6±19.1 °C |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 1,4-diacetylpiperazine-2,5-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 424.4±38.0 °C at 760 mmHg |
|---|
| Melting Point | 99-100ºC |
|---|
| Molecular Formula | C8H10N2O4 |
|---|
| Molecular Weight | 198.176 |
|---|
| Flash Point | 216.6±19.1 °C |
|---|
| Exact Mass | 198.064056 |
|---|
| PSA | 74.76000 |
|---|
| LogP | -0.80 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.526 |
|---|
| InChIKey | CBBKKVPJPRZOCM-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)N1CC(=O)N(C(C)=O)CC1=O |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H315-H317-H319 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338 |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36-S37-S39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2933599090 |
|---|
Customs
| HS Code | 2933599090 |
|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1,4-diacetyltetrahydro-2,5-pyrazinedione |
| N,N'-diacetyl-2,5-diketopiperazine |
| 1,4-Diacetyl-piperazine-2,5-dione |
| 1,4-Diacetyl-2,5-piperazinedione |
| 1,4-Diacetyl-2,5-dioxopiperazine |
| 1,4-diacetyl-2,5-diketopiperazine |
| N,N'-Diacetylglycine Anhydride |
| 2,5-Piperazinedione, 1,4-diacetyl- |
| CBBKKVPJPRZOCM-UHFFFAOYSA |
| N,N'-diacetyl-2,5-piperazinedione |
| N,N'-Diacetyl-2,5-dioxopiperazine |
| N,N'-diacetyl-cyclo(Gly-Gly) |
| 1,4-diacetylpiperazine-2,5-dione |
