Introduction:Basic information about CAS 852180-48-4|tert-butyl 4-[3-[(methylamino)methyl]benzyl]tetrahydro-1(2h)-pyrazinecarboxyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-butyl 4-[3-[(methylamino)methyl]benzyl]tetrahydro-1(2h)-pyrazinecarboxylate |
|---|
| CAS Number | 852180-48-4 | Molecular Weight | 319.44200 |
|---|
| Density | 1.08g/cm3 | Boiling Point | 413.3ºC at 760 mmHg |
|---|
| Molecular Formula | C18H29N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 203.8ºC |
|---|
Names
| Name | tert-butyl 4-[3-[(methylamino)methyl]benzyl]tetrahydro-1(2h)-pyrazinecarboxylate |
|---|
Chemical & Physical Properties
| Density | 1.08g/cm3 |
|---|
| Boiling Point | 413.3ºC at 760 mmHg |
|---|
| Molecular Formula | C18H29N3O2 |
|---|
| Molecular Weight | 319.44200 |
|---|
| Flash Point | 203.8ºC |
|---|
| Exact Mass | 319.22600 |
|---|
| PSA | 44.81000 |
|---|
| LogP | 2.72540 |
|---|
| Index of Refraction | 1.539 |
|---|
| InChIKey | VYJXRUKUWZBKEL-UHFFFAOYSA-N |
|---|
| SMILES | CNCc1cccc(CN2CCN(C(=O)OC(C)(C)C)CC2)c1 |
|---|