Introduction：Basic information about CAS 857284-25-4|[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methanol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methanol |
|---|
| CAS Number | 857284-25-4 | Molecular Weight | 259.24800 |
|---|
| Density | 1.403g/cm3 | Boiling Point | 363.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H8F3NOS | Melting Point | 107ºC |
|---|
| MSDS | / | Flash Point | 173.7ºC |
|---|
Names
| Name | [2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methanol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.403g/cm3 |
|---|
| Boiling Point | 363.6ºC at 760 mmHg |
|---|
| Melting Point | 107ºC |
|---|
| Molecular Formula | C11H8F3NOS |
|---|
| Molecular Weight | 259.24800 |
|---|
| Flash Point | 173.7ºC |
|---|
| Exact Mass | 259.02800 |
|---|
| PSA | 61.36000 |
|---|
| LogP | 3.32120 |
|---|
| Index of Refraction | 1.548 |
|---|
| InChIKey | LXSRKDWWLYYTMN-UHFFFAOYSA-N |
|---|
| SMILES | OCc1csc(-c2ccc(C(F)(F)F)cc2)n1 |
|---|
Synonyms
| [2-(4-trifluoromethyl-phenyl)-thiazol-4-yl]-methanol |
| {2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl}methanol |
