Introduction：Basic information about CAS 879896-53-4|2-BROMO-1-(4-THIEN-3-YLPHENYL)ETHANONE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-BROMO-1-(4-THIEN-3-YLPHENYL)ETHANONE |
|---|
| CAS Number | 879896-53-4 | Molecular Weight | 281.16800 |
|---|
| Density | 1.488g/cm3 | Boiling Point | 344.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9BrOS | Melting Point | 113-115ºC |
|---|
| MSDS | / | Flash Point | 162ºC |
|---|
Names
| Name | 2-bromo-1-(4-thiophen-3-ylphenyl)ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.488g/cm3 |
|---|
| Boiling Point | 344.2ºC at 760 mmHg |
|---|
| Melting Point | 113-115ºC |
|---|
| Molecular Formula | C12H9BrOS |
|---|
| Molecular Weight | 281.16800 |
|---|
| Flash Point | 162ºC |
|---|
| Exact Mass | 279.95600 |
|---|
| PSA | 45.31000 |
|---|
| LogP | 3.99270 |
|---|
| Index of Refraction | 1.627 |
|---|
| InChIKey | ZTZQYKSMNMDCKR-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CBr)c1ccc(-c2ccsc2)cc1 |
|---|
Synonyms
| 2-Bromo-1-(4-thien-3-ylphenyl)ethanone |
| Ethanone,2-bromo-1-[4-(3-thienyl)phenyl] |
| 4-(Thien-3-yl)phenacyl bromide |
