Introduction：Basic information about CAS 67724-08-7|spiramycin embonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | spiramycin embonate |
|---|
| CAS Number | 67724-08-7 | Molecular Weight | 3015.63000 |
|---|
| Density | / | Boiling Point | 913.7ºC at 760 mmHg |
|---|
| Molecular Formula | C157H244N6O50 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 506.4ºC |
|---|
Names
| Name | spiramycin embonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 913.7ºC at 760 mmHg |
|---|
| Molecular Formula | C157H244N6O50 |
|---|
| Molecular Weight | 3015.63000 |
|---|
| Flash Point | 506.4ºC |
|---|
| Exact Mass | 3013.67000 |
|---|
| PSA | 713.34000 |
|---|
| LogP | 12.89840 |
|---|
| InChIKey | BJKLPSFSLQTCGC-ZFURAGCBSA-N |
|---|
| SMILES | COC1C(O)CC(=O)OC(C)CC=CC=CC(OC2CCC(N(C)C)C(C)O2)C(C)CC(CC=O)C1OC1OC(C)C(OC2CC(C)(O)C(O)C(C)O2)C(N(C)C)C1O.O=C(O)c1cc2ccccc2c(Cc2c(O)c(C(=O)O)cc3ccccc23)c1O |
|---|
Synonyms
| Spiramycin/4,4'-Methylenebis(3-hydroxy-2-naphthalenecarboxylic acid) |
| Spiramycin,compd. with 4,4'-methylenebis[3-hydroxy-2-naphthalenecarboxylic acid] |
