Introduction:Basic information about CAS 128779-47-5|Boc-L-phe(4-ph)-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Boc-L-phe(4-ph)-OH |
|---|
| CAS Number | 128779-47-5 | Molecular Weight | 341.401 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 528.2±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H23NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 273.2±30.1 °C |
|---|
Names
| Name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-phenylphenyl)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 528.2±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H23NO4 |
|---|
| Molecular Weight | 341.401 |
|---|
| Flash Point | 273.2±30.1 °C |
|---|
| Exact Mass | 341.162720 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 4.72 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.560 |
|---|
| InChIKey | NBVVKAUSAGHTSU-QGZVFWFLSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(-c2ccccc2)cc1)C(=O)O |
|---|
| Storage condition | Store at RT. |
|---|
Safety Information
Synonyms
| (2R)-3-(4-Biphenylyl)-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid |
| (R)-3-([1,1'-Biphenyl]-4-yl)-2-((tert-butoxycarbonyl)amino)propanoic acid |
| (2R)-2-[(tert-butoxy)carbonylamino]-3-(4-phenylphenyl)propanoic acid |
| MFCD00191185 |
| N-t-Boc-L-biphenylalanine |
| Boc-L-phe(4-ph)-OH |
| N-tert-butoxycarbonyl-p-phenyl-L-phenylalanine |
| (S)-2-t-butoxycarbonylamino-3-(biphenyl-4-yl)-propionic acid |
| Boc-D-4,4-Biphenylalanine |
| (2R)-3-(4-Biphenylyl)-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid (non-preferred name) |
| N-Boc-3-(4-biphenylyl)-D-alanine |
| Boc-4-phenyl-phenylalanine |
| Boc-3-(4-Biphenylyl)-D-alanine |
| Boc-3-(4-biphenylyl)-L-alanine |
| Boc-L-4,4'-biphenylalanine |
| (2R)-3-(Biphenyl-4-yl)-2-[(tert-butoxycarbonyl)amino]propanoic acid (non-preferred name) |
| Boc-D-Bip-OH |
| BOC-D-BPH-OH |