Introduction:Basic information about CAS 4294-17-1|(2R,5S)-2-[6-(benzylamino)purin-9-yl]-6-(hydroxymethyl)oxane-3,4,5-triol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2R,5S)-2-[6-(benzylamino)purin-9-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|
| CAS Number | 4294-17-1 | Molecular Weight | 387.39000 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C18H21N5O5 | Melting Point | 179ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (2R,5S)-2-[6-(benzylamino)purin-9-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 179ºC |
|---|
| Molecular Formula | C18H21N5O5 |
|---|
| Molecular Weight | 387.39000 |
|---|
| Exact Mass | 387.15400 |
|---|
| PSA | 149.01000 |
|---|
| Index of Refraction | 1.762 |
|---|
| InChIKey | KRUUBWXADMDQSI-BWOYXGKQSA-N |
|---|
| SMILES | OCC1OC(n2cnc3c(NCc4ccccc4)ncnc32)C(O)C(O)C1O |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
Synonyms
| 6-Benzylaminopurine-9-glucoside |
| N6-Benzyladenine 9-glucoside |
| N-Benzyl-9-b-D-glucopyranosyladenine |
| N-Benzyl-9-glucosyladenine |
| 9-b-D-Glucopyranosyl-N-benzyladenine |