Introduction：Basic information about CAS 1590-02-9|2-Hydroxy-2-methylpropane-1,2,3-tricarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Hydroxy-2-methylpropane-1,2,3-tricarboxylic acid |
|---|
| CAS Number | 1590-02-9 | Molecular Weight | 190.15100 |
|---|
| Density | 1.485g/cm3 | Boiling Point | 273.3ºC at 760mmHg |
|---|
| Molecular Formula | C7H10O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 133.4ºC |
|---|
Names
| Name | 2-methylpropane-1,2,3-tricarboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.485g/cm3 |
|---|
| Boiling Point | 273.3ºC at 760mmHg |
|---|
| Molecular Formula | C7H10O6 |
|---|
| Molecular Weight | 190.15100 |
|---|
| Flash Point | 133.4ºC |
|---|
| Exact Mass | 190.04800 |
|---|
| PSA | 111.90000 |
|---|
| LogP | 0.02670 |
|---|
| Vapour Pressure | 0.0016mmHg at 25°C |
|---|
| Index of Refraction | 1.523 |
|---|
| InChIKey | GPICKHDXBPTBLD-UHFFFAOYSA-N |
|---|
| SMILES | CC(CC(=O)O)(CC(=O)O)C(=O)O |
|---|
Safety Information
Customs
| HS Code | 2917190090 |
|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| AC1Q5V7X |
| GPICKHDXBPTBLD-UHFFFAOYSA |
| 2-Methyl-propan-1,2,3-tricarbonsaeure |
| 2-methyl-1,2,3-propanetricarboxylic acid |
| 2-methyl-propane-1,2,3-tricarboxylic acid |
| 3-Methyl-3-methylsaeure-pentandisaeure |
| CTK0I3405 |
| AC1L2L84 |
