Introduction：Basic information about CAS 5314-37-4|4,4'-Biphenyldisulphonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,4'-Biphenyldisulphonic acid |
|---|
| CAS Number | 5314-37-4 | Molecular Weight | 314.334 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C12H10O6S2 | Melting Point | 143-145 °C(lit.) |
|---|
| MSDS | / | Flash Point | >230 °F |
|---|
Names
| Name | 4,4'-Biphenyldisulfonic Acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Melting Point | 143-145 °C(lit.) |
|---|
| Molecular Formula | C12H10O6S2 |
|---|
| Molecular Weight | 314.334 |
|---|
| Flash Point | >230 °F |
|---|
| Exact Mass | 313.991882 |
|---|
| PSA | 125.50000 |
|---|
| LogP | 0.30 |
|---|
| Index of Refraction | 1.640 |
|---|
| InChIKey | ABSXMLODUTXQDJ-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(O)c1ccc(-c2ccc(S(=O)(=O)O)cc2)cc1 |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | R22:Harmful if swallowed. R36/37/38:Irritating to eyes, respiratory system and skin . R41:Risk of serious damage to eyes. |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | 2585.0 |
|---|
| WGK Germany | 1 |
|---|
| RTECS | DU2800000 |
|---|
| Hazard Class | 8.0 |
|---|
| HS Code | 2904100000 |
|---|
Customs
| HS Code | 2904100000 |
|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| [1,1'-Biphenyl]-4,4'-disulfonic acid |
| 4-(4-sulfophenyl)benzenesulfonic acid |
| EINECS 226-169-2 |
| MFCD00035762 |
| 4,4'-Biphenyldisulphonic acid |
| 4,4'-Biphenyldisulfonic acid |
