Introduction：Basic information about CAS 35337-20-3|1-Nitro-6a,6b,9b,12c-tetrahydroperylene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Nitro-6a,6b,9b,12c-tetrahydroperylene |
|---|
| CAS Number | 35337-20-3 | Molecular Weight | 301.339 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 608.3±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H15NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 308.0±24.3 °C |
|---|
Names
| Name | 1-nitroperylene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 608.3±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H15NO2 |
|---|
| Molecular Weight | 301.339 |
|---|
| Flash Point | 308.0±24.3 °C |
|---|
| Exact Mass | 301.110291 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 3.75 |
|---|
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.722 |
|---|
| InChIKey | SVHPZPRMIMYOEG-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc2cccc3c4cccc5cccc(c1c23)c54 |
|---|
Safety Information
Customs
| HS Code | 2904209090 |
|---|
| Summary | 2904209090 derivatives containing only nitro or only nitroso groups。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 1-Nitroperylen |
| 1-nitroperilene |
| 1-pentylnitrate |
| 1-Nitro-6a,6b,9b,12c-tetrahydroperylene |
| Pentane,1-nitro |
| 1-nitro-pentane |
| 1-Nitro-pentan |
| amyl nitrite |
| 1-nitropenthane |
| Perylene, 6a,6b,9b,12c-tetrahydro-1-nitro- |
