Introduction:Basic information about CAS 59721-28-7|Camostat, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Camostat |
|---|
| CAS Number | 59721-28-7 | Molecular Weight | 398.413 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 634.6±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H22N4O5 | Melting Point | 194-198ºC |
|---|
| MSDS | / | Flash Point | 337.6±34.3 °C |
|---|
Names
| Name | [4-[2-[2-(dimethylamino)-2-oxoethoxy]-2-oxoethyl]phenyl] 4-(diaminomethylideneamino)benzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 634.6±65.0 °C at 760 mmHg |
|---|
| Melting Point | 194-198ºC |
|---|
| Molecular Formula | C20H22N4O5 |
|---|
| Molecular Weight | 398.413 |
|---|
| Flash Point | 337.6±34.3 °C |
|---|
| Exact Mass | 398.159027 |
|---|
| PSA | 134.81000 |
|---|
| LogP | 1.29 |
|---|
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.597 |
|---|
| InChIKey | XASIMHXSUQUHLV-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)C(=O)COC(=O)Cc1ccc(OC(=O)c2ccc(N=C(N)N)cc2)cc1 |
|---|
Synonyms
| Camostat [INN] |
| N,N-ddimethylcarbamoylmethyl p-(p-guanidinobenzoyloxy)phenylacetate |
| N,N-dimethyl-carbamoylmethyl-p-(p-guanidinobenzoyloxy)-phenylacetate |
| FOY-305 |
| Camostat |
| 4-[[4-[(Aminoiminomethyl)amino]benzoyl]oxy]benzeneacetic Acid 2-(Dimethylamino)-2-oxoethyl Ester |
| Dimethylcarbamoylmethyl 4-(4-guqnidinobenzoyloxy)phenylacetat |
| p-(p-guanidinobenzoyloxy)phenylacetic acid N,N-dimethylcarbamoylmethyl ester |
| foypan |
| 4-{2-[2-(Dimethylamino)-2-oxoethoxy]-2-oxoethyl}phenyl 4-carbamimidamidobenzoate |
| camostate |
| Benzeneacetic acid, 4-[[4-[(aminoiminomethyl)amino]benzoyl]oxy]-, 2-(dimethylamino)-2-oxoethyl ester |
| Camostatum [INN-Latin] |
| N,N-Dimethylcarbamoylmethyl-p-(p-guanidinobenzoyloxy)phenylacetate |