Introduction:Basic information about CAS 5342-97-2|tert-Butyl 3,5-dinitrobenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-Butyl 3,5-dinitrobenzoate |
|---|
| CAS Number | 5342-97-2 | Molecular Weight | 268.22300 |
|---|
| Density | 1.337 g/cm3 | Boiling Point | 376.5ºC at 760 mmHg |
|---|
| Molecular Formula | C11H12N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 161.3ºC |
|---|
Names
| Name | tert-Butyl 3,5-dinitrobenzoate |
|---|
| Synonym | More Synonyms |
|---|
tert-Butyl 3,5-dinitrobenzoate BiologicalActivity
| Description | Tert-butyl 3,5-dinitrobenzoate is an intermediate or reactant in organic synthesis and can also play a role in drug synthesis, dye preparation and other chemical fields.The nitro functional group of Tert-butyl 3,5-dinitrobenzoate has certain reactivity in organic chemistry and can participate in various reactions, such as electrophilic substitution, aromatic amine reaction, etc[1]. |
|---|
| Related Catalog | Research Areas >>CancerSignaling Pathways >>Others >>Others |
|---|
Chemical & Physical Properties
| Density | 1.337 g/cm3 |
|---|
| Boiling Point | 376.5ºC at 760 mmHg |
|---|
| Molecular Formula | C11H12N2O6 |
|---|
| Molecular Weight | 268.22300 |
|---|
| Flash Point | 161.3ºC |
|---|
| Exact Mass | 268.07000 |
|---|
| PSA | 117.94000 |
|---|
| LogP | 3.50470 |
|---|
| Index of Refraction | 1.561 |
|---|
| InChIKey | JETCTPYQTQUQPA-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Safety Phrases | 26-36/37 |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| t-butyl 3,5-dinitrobenzoate |
| 3,5-dinitro-benzoic acid tert-butyl ester |
| 3.5-Dinitro-benzoesaeure-tert.-butylester |
| 3.5-Dinitro-benzoesaeure-1.1-dimethyl-aethylester |
| tert.-Butyl-(3.5-dinitro-benzoat) |
| AB1288 |