Introduction：Basic information about CAS 435342-23-7|3-methyl-5-morpholin-4-ylmethyl-furan-2-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-methyl-5-morpholin-4-ylmethyl-furan-2-carboxylic acid |
|---|
| CAS Number | 435342-23-7 | Molecular Weight | 225.24100 |
|---|
| Density | 1.262g/cm3 | Boiling Point | 362.8ºC at 760mmHg |
|---|
| Molecular Formula | C11H15NO4 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 173.2ºC |
|---|
Names
| Name | 3-methyl-5-morpholin-4-ylmethyl-furan-2-carboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.262g/cm3 |
|---|
| Boiling Point | 362.8ºC at 760mmHg |
|---|
| Molecular Formula | C11H15NO4 |
|---|
| Molecular Weight | 225.24100 |
|---|
| Flash Point | 173.2ºC |
|---|
| Exact Mass | 225.10000 |
|---|
| PSA | 62.91000 |
|---|
| LogP | 1.05630 |
|---|
| Index of Refraction | 1.549 |
|---|
| InChIKey | BQEFURKTNUMUPV-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(CN2CCOCC2)oc1C(=O)O.Cl |
|---|
