Introduction：Basic information about CAS 51070-57-6|2-[(1,1-dioxothiolan-3-yl)amino]butanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[(1,1-dioxothiolan-3-yl)amino]butanoic acid |
|---|
| CAS Number | 51070-57-6 | Molecular Weight | 221.27400 |
|---|
| Density | 1.33g/cm3 | Boiling Point | 469.9ºC at 760 mmHg |
|---|
| Molecular Formula | C8H15NO4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 238ºC |
|---|
Names
| Name | 2-[(1,1-dioxothiolan-3-yl)amino]butanoic acid |
|---|
Chemical & Physical Properties
| Density | 1.33g/cm3 |
|---|
| Boiling Point | 469.9ºC at 760 mmHg |
|---|
| Molecular Formula | C8H15NO4S |
|---|
| Molecular Weight | 221.27400 |
|---|
| Flash Point | 238ºC |
|---|
| Exact Mass | 221.07200 |
|---|
| PSA | 91.85000 |
|---|
| LogP | 1.09800 |
|---|
| Index of Refraction | 1.528 |
|---|
| InChIKey | SMVDAGFJQFGLJZ-UHFFFAOYSA-N |
|---|
| SMILES | CCC(NC1CCS(=O)(=O)C1)C(=O)O |
|---|
Safety Information
